ChemNet > CAS > 43088-67-1 4-chloro-5-methylthieno[2,3-d]pyrimidine
43088-67-1 4-chloro-5-methylthieno[2,3-d]pyrimidine
| product Name |
4-chloro-5-methylthieno[2,3-d]pyrimidine |
| CAS No |
43088-67-1 |
| Molecular Formula |
C7H5ClN2S |
| Molecular Weight |
184.646 |
| InChI |
InChI=1/C7H5ClN2S/c1-4-2-11-7-5(4)6(8)9-3-10-7/h2-3H,1H3 |
| Molecular Structure |
![43088-67-1 4-chloro-5-methylthieno[2,3-d]pyrimidine](https://images-a.chemnet.com/suppliers/chembase/172/17212.gif)
|
| Density |
1.445g/cm3 |
| Melting point |
138℃ |
| Boiling point |
301.3°C at 760 mmHg |
| Refractive index |
1.682 |
| Flash point |
136°C |
| Vapour Pressur |
0.0019mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
